C16H18O7 — CID 54696667
2-(4-hydroxy-2-oxo-3-pentoxychromen-6-yl)oxyacetic acid (PubChem CID 54696667) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxo-3-pentoxychromen-6-yl)oxyacetic acid.
| Compound Name | 2-(4-hydroxy-2-oxo-3-pentoxychromen-6-yl)oxyacetic acid |
|---|---|
| PubChem CID | 54696667 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-(4-hydroxy-2-oxo-3-pentoxychromen-6-yl)oxyacetic acid |
| SMILES | CCCCCOc1c(O)c2cc(OCC(=O)O)ccc2oc1=O |
| InChI | InChI=1S/C16H18O7/c1-2-3-4-7-21-15-14(19)11-8-10(22-9-13(17)18)5-6-12(11)23-16(15)20/h5-6,8,19H,2-4,7,9H2,1H3,(H,17,18) |
| InChIKey | HIFWAXOYOCGFPY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|