C21H26O7 — CID 54696690
2-[3-[(E)-dec-1-enoxy]-4-hydroxy-2-oxochromen-6-yl]oxyacetic acid (PubChem CID 54696690) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-[3-[(E)-dec-1-enoxy]-4-hydroxy-2-oxochromen-6-yl]oxyacetic acid.
| Compound Name | 2-[3-[(E)-dec-1-enoxy]-4-hydroxy-2-oxochromen-6-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54696690 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[3-[(E)-dec-1-enoxy]-4-hydroxy-2-oxochromen-6-yl]oxyacetic acid |
| SMILES | CCCCCCCC/C=C/Oc1c(O)c2cc(OCC(=O)O)ccc2oc1=O |
| InChI | InChI=1S/C21H26O7/c1-2-3-4-5-6-7-8-9-12-26-20-19(24)16-13-15(27-14-18(22)23)10-11-17(16)28-21(20)25/h9-13,24H,2-8,14H2,1H3,(H,22,23)/b12-9+ |
| InChIKey | OTBSZZYQCVVJCU-FMIVXFBMSA-N |
| XLogP | 4.61 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|