C21H28O7 — CID 54696765
8-(3,4-dihydroxybutoxy)-4-hydroxy-3-[(E)-oct-1-enoxy]chromen-2-one (PubChem CID 54696765) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 8-(3,4-dihydroxybutoxy)-4-hydroxy-3-[(E)-oct-1-enoxy]chromen-2-one.
| Compound Name | 8-(3,4-dihydroxybutoxy)-4-hydroxy-3-[(E)-oct-1-enoxy]chromen-2-one |
|---|---|
| PubChem CID | 54696765 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 8-(3,4-dihydroxybutoxy)-4-hydroxy-3-[(E)-oct-1-enoxy]chromen-2-one |
| SMILES | CCCCCC/C=C/Oc1c(O)c2cccc(OCCC(O)CO)c2oc1=O |
| InChI | InChI=1S/C21H28O7/c1-2-3-4-5-6-7-12-27-20-18(24)16-9-8-10-17(19(16)28-21(20)25)26-13-11-15(23)14-22/h7-10,12,15,22-24H,2-6,11,13-14H2,1H3/b12-7+ |
| InChIKey | VHRLFQVNACGFBH-KPKJPENVSA-N |
| XLogP | 3.48 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|