C21H28O6 — CID 174466522
5-(3,4-dihydroxybutoxy)-4-hydroxy-3-oct-1-enylchromen-2-one (PubChem CID 174466522) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 5-(3,4-dihydroxybutoxy)-4-hydroxy-3-oct-1-enylchromen-2-one.
| Compound Name | 5-(3,4-dihydroxybutoxy)-4-hydroxy-3-oct-1-enylchromen-2-one |
|---|---|
| PubChem CID | 174466522 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 5-(3,4-dihydroxybutoxy)-4-hydroxy-3-oct-1-enylchromen-2-one |
| SMILES | CCCCCCC=Cc1c(O)c2c(OCCC(O)CO)cccc2oc1=O |
| InChI | InChI=1S/C21H28O6/c1-2-3-4-5-6-7-9-16-20(24)19-17(26-13-12-15(23)14-22)10-8-11-18(19)27-21(16)25/h7-11,15,22-24H,2-6,12-14H2,1H3 |
| InChIKey | YRBVABOLRLNZDU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|