C20H28O7 — CID 54696723
5-(2,3-dihydroxypropoxy)-4-hydroxy-3-octoxychromen-2-one (PubChem CID 54696723) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropoxy)-4-hydroxy-3-octoxychromen-2-one.
| Compound Name | 5-(2,3-dihydroxypropoxy)-4-hydroxy-3-octoxychromen-2-one |
|---|---|
| PubChem CID | 54696723 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 5-(2,3-dihydroxypropoxy)-4-hydroxy-3-octoxychromen-2-one |
| SMILES | CCCCCCCCOc1c(O)c2c(OCC(O)CO)cccc2oc1=O |
| InChI | InChI=1S/C20H28O7/c1-2-3-4-5-6-7-11-25-19-18(23)17-15(26-13-14(22)12-21)9-8-10-16(17)27-20(19)24/h8-10,14,21-23H,2-7,11-13H2,1H3 |
| InChIKey | JZYYBTGOYLOHDF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|