C22H32O6 — CID 174454280
3-decyl-7-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one (PubChem CID 174454280) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is 3-decyl-7-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one.
| Compound Name | 3-decyl-7-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 174454280 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-decyl-7-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one |
| SMILES | CCCCCCCCCCc1c(O)c2ccc(OCC(O)CO)cc2oc1=O |
| InChI | InChI=1S/C22H32O6/c1-2-3-4-5-6-7-8-9-10-19-21(25)18-12-11-17(27-15-16(24)14-23)13-20(18)28-22(19)26/h11-13,16,23-25H,2-10,14-15H2,1H3 |
| InChIKey | VRXABJFCDXOSJG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|