C20H26O7 — CID 87968008
3-butoxy-5-[2-(1,3-dioxolan-4-yl)-2-methylpropoxy]-4-hydroxychromen-2-one (PubChem CID 87968008) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-butoxy-5-[2-(1,3-dioxolan-4-yl)-2-methylpropoxy]-4-hydroxychromen-2-one.
| Compound Name | 3-butoxy-5-[2-(1,3-dioxolan-4-yl)-2-methylpropoxy]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 87968008 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-butoxy-5-[2-(1,3-dioxolan-4-yl)-2-methylpropoxy]-4-hydroxychromen-2-one |
| SMILES | CCCCOc1c(O)c2c(OCC(C)(C)C3COCO3)cccc2oc1=O |
| InChI | InChI=1S/C20H26O7/c1-4-5-9-24-18-17(21)16-13(7-6-8-14(16)27-19(18)22)25-11-20(2,3)15-10-23-12-26-15/h6-8,15,21H,4-5,9-12H2,1-3H3 |
| InChIKey | LHXWAPMRXCWCQH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|