C19H22O7 — CID 54697059
2-[4-hydroxy-3-[(E)-oct-1-enoxy]-2-oxochromen-5-yl]oxyacetic acid (PubChem CID 54697059) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-[4-hydroxy-3-[(E)-oct-1-enoxy]-2-oxochromen-5-yl]oxyacetic acid.
| Compound Name | 2-[4-hydroxy-3-[(E)-oct-1-enoxy]-2-oxochromen-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54697059 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[4-hydroxy-3-[(E)-oct-1-enoxy]-2-oxochromen-5-yl]oxyacetic acid |
| SMILES | CCCCCC/C=C/Oc1c(O)c2c(OCC(=O)O)cccc2oc1=O |
| InChI | InChI=1S/C19H22O7/c1-2-3-4-5-6-7-11-24-18-17(22)16-13(25-12-15(20)21)9-8-10-14(16)26-19(18)23/h7-11,22H,2-6,12H2,1H3,(H,20,21)/b11-7+ |
| InChIKey | HCPWTPIDZDWXER-YRNVUSSQSA-N |
| XLogP | 3.82 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|