About 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one
8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one (PubChem CID 54697040) has the molecular formula C18H22O7
and a molecular weight of 350.37 g/mol. Its IUPAC name is 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one |
| PubChem CID | 54697040 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one |
| SMILES | CCCC/C=C/Oc1c(O)c2cccc(OCC(O)CO)c2oc1=O |
| InChI | InChI=1S/C18H22O7/c1-2-3-4-5-9-23-17-15(21)13-7-6-8-14(16(13)25-18(17)22)24-11-12(20)10-19/h5-9,12,19-21H,2-4,10-11H2,1H3/b9-5+ |
| InChIKey | KNWODEDGAXIPEF-WEVVVXLNSA-N |
| XLogP | 2.31 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one?
The IUPAC name of 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one (CID 54697040) is 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one.
What is the SMILES notation for 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one?
The canonical SMILES for 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one is CCCC/C=C/Oc1c(O)c2cccc(OCC(O)CO)c2oc1=O.
What is the InChIKey of 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one?
The InChIKey is KNWODEDGAXIPEF-WEVVVXLNSA-N. The full InChI is InChI=1S/C18H22O7/c1-2-3-4-5-9-23-17-15(21)13-7-6-8-14(16(13)25-18(17)22)24-11-12(20)10-19/h5-9,12,19-21H,2-4,10-11H2,1H3/b9-5+.
What are the key properties of 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one?
8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one has a molecular weight of 350.37 g/mol, XLogP of 2.31, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,3-dihydroxypropoxy)-3-[(E)-hex-1-enoxy]-4-hydroxychromen-2-one is sourced from PubChem (CID 54697040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).