C16H20O7 — CID 54696810
3-butoxy-8-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one (PubChem CID 54696810) has the molecular formula C16H20O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is 3-butoxy-8-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one.
| Compound Name | 3-butoxy-8-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54696810 |
| Molecular Formula | C16H20O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-butoxy-8-(2,3-dihydroxypropoxy)-4-hydroxychromen-2-one |
| SMILES | CCCCOc1c(O)c2cccc(OCC(O)CO)c2oc1=O |
| InChI | InChI=1S/C16H20O7/c1-2-3-7-21-15-13(19)11-5-4-6-12(14(11)23-16(15)20)22-9-10(18)8-17/h4-6,10,17-19H,2-3,7-9H2,1H3 |
| InChIKey | DLJIYWPDSFDRNN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|