C17H22O6 — CID 54697049
4-hydroxy-8-(2-hydroxyethoxy)-3-(4-methylpentoxy)chromen-2-one (PubChem CID 54697049) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-hydroxy-8-(2-hydroxyethoxy)-3-(4-methylpentoxy)chromen-2-one.
| Compound Name | 4-hydroxy-8-(2-hydroxyethoxy)-3-(4-methylpentoxy)chromen-2-one |
|---|---|
| PubChem CID | 54697049 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-hydroxy-8-(2-hydroxyethoxy)-3-(4-methylpentoxy)chromen-2-one |
| SMILES | CC(C)CCCOc1c(O)c2cccc(OCCO)c2oc1=O |
| InChI | InChI=1S/C17H22O6/c1-11(2)5-4-9-22-16-14(19)12-6-3-7-13(21-10-8-18)15(12)23-17(16)20/h3,6-7,11,18-19H,4-5,8-10H2,1-2H3 |
| InChIKey | WHHBYZJEMWZOPV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|