C19H24O7 — CID 174426552
6-(3-butoxy-4-hydroxy-2-oxochromen-8-yl)oxyhexanoic acid (PubChem CID 174426552) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is 6-(3-butoxy-4-hydroxy-2-oxochromen-8-yl)oxyhexanoic acid.
| Compound Name | 6-(3-butoxy-4-hydroxy-2-oxochromen-8-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 174426552 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 6-(3-butoxy-4-hydroxy-2-oxochromen-8-yl)oxyhexanoic acid |
| SMILES | CCCCOc1c(O)c2cccc(OCCCCCC(=O)O)c2oc1=O |
| InChI | InChI=1S/C19H24O7/c1-2-3-11-25-18-16(22)13-8-7-9-14(17(13)26-19(18)23)24-12-6-4-5-10-15(20)21/h7-9,22H,2-6,10-12H2,1H3,(H,20,21) |
| InChIKey | SILIUNWYWWIORH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|