C22H30O7 — CID 174454221
4-hydroxy-6-(5-hydroxy-3-oxopentoxy)-3-octoxychromen-2-one (PubChem CID 174454221) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-hydroxy-6-(5-hydroxy-3-oxopentoxy)-3-octoxychromen-2-one.
| Compound Name | 4-hydroxy-6-(5-hydroxy-3-oxopentoxy)-3-octoxychromen-2-one |
|---|---|
| PubChem CID | 174454221 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-hydroxy-6-(5-hydroxy-3-oxopentoxy)-3-octoxychromen-2-one |
| SMILES | CCCCCCCCOc1c(O)c2cc(OCCC(=O)CCO)ccc2oc1=O |
| InChI | InChI=1S/C22H30O7/c1-2-3-4-5-6-7-13-28-21-20(25)18-15-17(8-9-19(18)29-22(21)26)27-14-11-16(24)10-12-23/h8-9,15,23,25H,2-7,10-14H2,1H3 |
| InChIKey | SVYLZEKZMLMDPO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|