C18H24O6 — CID 54697002
4-hydroxy-6-(3-hydroxypropoxy)-3-(2-methylpentoxy)chromen-2-one (PubChem CID 54697002) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 4-hydroxy-6-(3-hydroxypropoxy)-3-(2-methylpentoxy)chromen-2-one.
| Compound Name | 4-hydroxy-6-(3-hydroxypropoxy)-3-(2-methylpentoxy)chromen-2-one |
|---|---|
| PubChem CID | 54697002 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 4-hydroxy-6-(3-hydroxypropoxy)-3-(2-methylpentoxy)chromen-2-one |
| SMILES | CCCC(C)COc1c(O)c2cc(OCCCO)ccc2oc1=O |
| InChI | InChI=1S/C18H24O6/c1-3-5-12(2)11-23-17-16(20)14-10-13(22-9-4-8-19)6-7-15(14)24-18(17)21/h6-7,10,12,19-20H,3-5,8-9,11H2,1-2H3 |
| InChIKey | VYCGTDABCXHSFB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|