C14H16O7 — CID 54697017
6-(3,4-dihydroxybutoxy)-4-hydroxy-3-methoxychromen-2-one (PubChem CID 54697017) has the molecular formula C14H16O7 and a molecular weight of 296.28 g/mol. Its IUPAC name is 6-(3,4-dihydroxybutoxy)-4-hydroxy-3-methoxychromen-2-one.
| Compound Name | 6-(3,4-dihydroxybutoxy)-4-hydroxy-3-methoxychromen-2-one |
|---|---|
| PubChem CID | 54697017 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 6-(3,4-dihydroxybutoxy)-4-hydroxy-3-methoxychromen-2-one |
| SMILES | COc1c(O)c2cc(OCCC(O)CO)ccc2oc1=O |
| InChI | InChI=1S/C14H16O7/c1-19-13-12(17)10-6-9(20-5-4-8(16)7-15)2-3-11(10)21-14(13)18/h2-3,6,8,15-17H,4-5,7H2,1H3 |
| InChIKey | AXDYIKDDHLGQOC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|