C15H16O6 — CID 87969142
4-hydroxy-7-(3-hydroxypropoxy)-3-prop-1-enoxychromen-2-one (PubChem CID 87969142) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-hydroxy-7-(3-hydroxypropoxy)-3-prop-1-enoxychromen-2-one.
| Compound Name | 4-hydroxy-7-(3-hydroxypropoxy)-3-prop-1-enoxychromen-2-one |
|---|---|
| PubChem CID | 87969142 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-hydroxy-7-(3-hydroxypropoxy)-3-prop-1-enoxychromen-2-one |
| SMILES | CC=COc1c(O)c2ccc(OCCCO)cc2oc1=O |
| InChI | InChI=1S/C15H16O6/c1-2-7-20-14-13(17)11-5-4-10(19-8-3-6-16)9-12(11)21-15(14)18/h2,4-5,7,9,16-17H,3,6,8H2,1H3 |
| InChIKey | IBOIKTJPADZLTO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|