C16H16O7 — CID 54696733
2-[4-hydroxy-3-(3-methylbut-2-enoxy)-2-oxochromen-7-yl]oxyacetic acid (PubChem CID 54696733) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-[4-hydroxy-3-(3-methylbut-2-enoxy)-2-oxochromen-7-yl]oxyacetic acid.
| Compound Name | 2-[4-hydroxy-3-(3-methylbut-2-enoxy)-2-oxochromen-7-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54696733 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[4-hydroxy-3-(3-methylbut-2-enoxy)-2-oxochromen-7-yl]oxyacetic acid |
| SMILES | CC(C)=CCOc1c(O)c2ccc(OCC(=O)O)cc2oc1=O |
| InChI | InChI=1S/C16H16O7/c1-9(2)5-6-21-15-14(19)11-4-3-10(22-8-13(17)18)7-12(11)23-16(15)20/h3-5,7,19H,6,8H2,1-2H3,(H,17,18) |
| InChIKey | KBLDWAFYRKAIJO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|