C19H17ClO4 — CID 702026
ethyl 5-[(3-chlorophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 702026) has the molecular formula C19H17ClO4 and a molecular weight of 344.79 g/mol. Its IUPAC name is ethyl 5-[(3-chlorophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[(3-chlorophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 702026 |
| Molecular Formula | C19H17ClO4 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 5-[(3-chlorophenyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(OCc3cccc(Cl)c3)cc12 |
| InChI | InChI=1S/C19H17ClO4/c1-3-22-19(21)18-12(2)24-17-8-7-15(10-16(17)18)23-11-13-5-4-6-14(20)9-13/h4-10H,3,11H2,1-2H3 |
| InChIKey | KUNRJLHCTMGQIF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |