C19H26O4 — CID 170599447
ethane;ethyl 5-(cyclobutylmethoxy)-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 170599447) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is ethane;ethyl 5-(cyclobutylmethoxy)-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethane;ethyl 5-(cyclobutylmethoxy)-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 170599447 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethane;ethyl 5-(cyclobutylmethoxy)-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CC.CCOC(=O)c1c(C)oc2ccc(OCC3CCC3)cc12 |
| InChI | InChI=1S/C17H20O4.C2H6/c1-3-19-17(18)16-11(2)21-15-8-7-13(9-14(15)16)20-10-12-5-4-6-12;1-2/h7-9,12H,3-6,10H2,1-2H3;1-2H3 |
| InChIKey | JVXFWPQMYAZJKT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |