C20H26N2O5 — CID 170347624
2-[[5-(cyclopentylmethoxy)-2-methyl-1-benzofuran-3-yl]-formylamino]-3-hydroxy-2-methylpropanamide (PubChem CID 170347624) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-[[5-(cyclopentylmethoxy)-2-methyl-1-benzofuran-3-yl]-formylamino]-3-hydroxy-2-methylpropanamide.
| Compound Name | 2-[[5-(cyclopentylmethoxy)-2-methyl-1-benzofuran-3-yl]-formylamino]-3-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 170347624 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-[[5-(cyclopentylmethoxy)-2-methyl-1-benzofuran-3-yl]-formylamino]-3-hydroxy-2-methylpropanamide |
| SMILES | Cc1oc2ccc(OCC3CCCC3)cc2c1N(C=O)C(C)(CO)C(N)=O |
| InChI | InChI=1S/C20H26N2O5/c1-13-18(22(12-24)20(2,11-23)19(21)25)16-9-15(7-8-17(16)27-13)26-10-14-5-3-4-6-14/h7-9,12,14,23H,3-6,10-11H2,1-2H3,(H2,21,25) |
| InChIKey | DESFUAGVAJMCQN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|