C14H14O4 — CID 178129111
5-[cyclopropyl(dideuterio)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid (PubChem CID 178129111) has the molecular formula C14H14O4 and a molecular weight of 248.27 g/mol. Its IUPAC name is 5-[cyclopropyl(dideuterio)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid.
| Compound Name | 5-[cyclopropyl(dideuterio)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 178129111 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-[cyclopropyl(dideuterio)methoxy]-2-methyl-1-benzofuran-3-carboxylic acid |
| SMILES | [2H]C([2H])(Oc1ccc2oc(C)c(C(=O)O)c2c1)C1CC1 |
| InChI | InChI=1S/C14H14O4/c1-8-13(14(15)16)11-6-10(4-5-12(11)18-8)17-7-9-2-3-9/h4-6,9H,2-3,7H2,1H3,(H,15,16)/i7D2 |
| InChIKey | METBKOXOSBPHFQ-RJSZUWSASA-N |
| XLogP | 3.23 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |