C10H9NO3 — CID 130670349
5-amino-2-methyl-1-benzofuran-3-carboxylic acid (PubChem CID 130670349) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 5-amino-2-methyl-1-benzofuran-3-carboxylic acid.
| Compound Name | 5-amino-2-methyl-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 130670349 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 5-amino-2-methyl-1-benzofuran-3-carboxylic acid |
| SMILES | Cc1oc2ccc(N)cc2c1C(=O)O |
| InChI | InChI=1S/C10H9NO3/c1-5-9(10(12)13)7-4-6(11)2-3-8(7)14-5/h2-4H,11H2,1H3,(H,12,13) |
| InChIKey | OGQVYOOKRMWLPE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|