C15H13F3O4 — CID 170347452
2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]methoxy]-1-benzofuran-3-carboxylic acid (PubChem CID 170347452) has the molecular formula C15H13F3O4 and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]methoxy]-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]methoxy]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 170347452 |
| Molecular Formula | C15H13F3O4 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-methyl-5-[[1-(trifluoromethyl)cyclopropyl]methoxy]-1-benzofuran-3-carboxylic acid |
| SMILES | Cc1oc2ccc(OCC3(C(F)(F)F)CC3)cc2c1C(=O)O |
| InChI | InChI=1S/C15H13F3O4/c1-8-12(13(19)20)10-6-9(2-3-11(10)22-8)21-7-14(4-5-14)15(16,17)18/h2-3,6H,4-5,7H2,1H3,(H,19,20) |
| InChIKey | WZQQCLKGKDHITQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |