C19H21NO5 — CID 163380500
ethane;2-methyl-5-[(1-methyl-6-oxo-2-pyridinyl)methoxy]-1-benzofuran-3-carboxylic acid (PubChem CID 163380500) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethane;2-methyl-5-[(1-methyl-6-oxo-2-pyridinyl)methoxy]-1-benzofuran-3-carboxylic acid.
| Compound Name | ethane;2-methyl-5-[(1-methyl-6-oxo-2-pyridinyl)methoxy]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 163380500 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethane;2-methyl-5-[(1-methyl-6-oxo-2-pyridinyl)methoxy]-1-benzofuran-3-carboxylic acid |
| SMILES | CC.Cc1oc2ccc(OCc3cccc(=O)n3C)cc2c1C(=O)O |
| InChI | InChI=1S/C17H15NO5.C2H6/c1-10-16(17(20)21)13-8-12(6-7-14(13)23-10)22-9-11-4-3-5-15(19)18(11)2;1-2/h3-8H,9H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | HCKRTUDRLSRUPD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |