C17H20N2O4 — CID 163380236
ethane;2-methyl-5-[(1-methylimidazol-2-yl)methoxy]-1-benzofuran-3-carboxylic acid (PubChem CID 163380236) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethane;2-methyl-5-[(1-methylimidazol-2-yl)methoxy]-1-benzofuran-3-carboxylic acid.
| Compound Name | ethane;2-methyl-5-[(1-methylimidazol-2-yl)methoxy]-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 163380236 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | ethane;2-methyl-5-[(1-methylimidazol-2-yl)methoxy]-1-benzofuran-3-carboxylic acid |
| SMILES | CC.Cc1oc2ccc(OCc3nccn3C)cc2c1C(=O)O |
| InChI | InChI=1S/C15H14N2O4.C2H6/c1-9-14(15(18)19)11-7-10(3-4-12(11)21-9)20-8-13-16-5-6-17(13)2;1-2/h3-7H,8H2,1-2H3,(H,18,19);1-2H3 |
| InChIKey | LMXOLQOMMNKQJI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |