C18H16ClNO4 — CID 163380731
ethyl 5-[(2-chloro-3-pyridinyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate (PubChem CID 163380731) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is ethyl 5-[(2-chloro-3-pyridinyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate.
| Compound Name | ethyl 5-[(2-chloro-3-pyridinyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 163380731 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | ethyl 5-[(2-chloro-3-pyridinyl)methoxy]-2-methyl-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ccc(OCc3cccnc3Cl)cc12 |
| InChI | InChI=1S/C18H16ClNO4/c1-3-22-18(21)16-11(2)24-15-7-6-13(9-14(15)16)23-10-12-5-4-8-20-17(12)19/h4-9H,3,10H2,1-2H3 |
| InChIKey | UOMNSYBJZBMFLZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|