C18H21NO5 — CID 71892020
ethyl 2-methyl-5-(oxane-4-carbonyloxy)-1H-indole-3-carboxylate (PubChem CID 71892020) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-methyl-5-(oxane-4-carbonyloxy)-1H-indole-3-carboxylate.
| Compound Name | ethyl 2-methyl-5-(oxane-4-carbonyloxy)-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 71892020 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 2-methyl-5-(oxane-4-carbonyloxy)-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c2ccc(OC(=O)C3CCOCC3)cc12 |
| InChI | InChI=1S/C18H21NO5/c1-3-23-18(21)16-11(2)19-15-5-4-13(10-14(15)16)24-17(20)12-6-8-22-9-7-12/h4-5,10,12,19H,3,6-9H2,1-2H3 |
| InChIKey | VBRZPAYPPSQWOC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|