About [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate
[3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate (PubChem CID 175573902) has the molecular formula C16H20O5
and a molecular weight of 292.33 g/mol. Its IUPAC name is [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate.
Molecular Properties
| Compound Name | [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate |
| PubChem CID | 175573902 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate |
| SMILES | CCOC(=O)CCc1cccc(OC(=O)C2CCOC2)c1 |
| InChI | InChI=1S/C16H20O5/c1-2-20-15(17)7-6-12-4-3-5-14(10-12)21-16(18)13-8-9-19-11-13/h3-5,10,13H,2,6-9,11H2,1H3 |
| InChIKey | WCWOGWJRRJEWPL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate?
The IUPAC name of [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate (CID 175573902) is [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate.
What is the SMILES notation for [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate?
The canonical SMILES for [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate is CCOC(=O)CCc1cccc(OC(=O)C2CCOC2)c1.
What is the InChIKey of [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate?
The InChIKey is WCWOGWJRRJEWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O5/c1-2-20-15(17)7-6-12-4-3-5-14(10-12)21-16(18)13-8-9-19-11-13/h3-5,10,13H,2,6-9,11H2,1H3.
What are the key properties of [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate?
[3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate has a molecular weight of 292.33 g/mol, XLogP of 2.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-ethoxy-3-oxopropyl)phenyl] oxolane-3-carboxylate is sourced from PubChem (CID 175573902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).