C19H28O5 — CID 18766548
tert-butyl 2-[3-(3-ethoxy-3-oxopropyl)phenoxy]-2-methylpropanoate (PubChem CID 18766548) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl 2-[3-(3-ethoxy-3-oxopropyl)phenoxy]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[3-(3-ethoxy-3-oxopropyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 18766548 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl 2-[3-(3-ethoxy-3-oxopropyl)phenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)CCc1cccc(OC(C)(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H28O5/c1-7-22-16(20)12-11-14-9-8-10-15(13-14)23-19(5,6)17(21)24-18(2,3)4/h8-10,13H,7,11-12H2,1-6H3 |
| InChIKey | ZZJQXULPWUHZLV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |