tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate

C21H26O3 — CID 59138328

IUPACtert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate
SMILESCc1ccc(-c2cccc(OC(C)(C)C(=O)OC(C)(C)C)c2)cc1
InChIInChI=1S/C21H26O3/c1-15-10-12-16(13-11-15)17-8-7-9-18(14-17)23-21(5,6)19(22)24-20(2,3)4/h7-14H,1-6H3
InChIKeyKDPGCYCDLWGLFX-UHFFFAOYSA-N
MW326.44 g/mol
LogP5.16
Rot. Bonds4

About tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate

tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate (PubChem CID 59138328) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate.

Molecular Properties

Compound Nametert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate
PubChem CID59138328
Molecular FormulaC21H26O3
Molecular Weight326.44 g/mol
Exact Mass326.19
IUPAC Nametert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate
SMILESCc1ccc(-c2cccc(OC(C)(C)C(=O)OC(C)(C)C)c2)cc1
InChIInChI=1S/C21H26O3/c1-15-10-12-16(13-11-15)17-8-7-9-18(14-17)23-21(5,6)19(22)24-20(2,3)4/h7-14H,1-6H3
InChIKeyKDPGCYCDLWGLFX-UHFFFAOYSA-N
XLogP5.16
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500326.44
LogP ≤ 55.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate?
The IUPAC name of tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate (CID 59138328) is tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate.
What is the SMILES notation for tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate?
The canonical SMILES for tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate is Cc1ccc(-c2cccc(OC(C)(C)C(=O)OC(C)(C)C)c2)cc1.
What is the InChIKey of tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate?
The InChIKey is KDPGCYCDLWGLFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O3/c1-15-10-12-16(13-11-15)17-8-7-9-18(14-17)23-21(5,6)19(22)24-20(2,3)4/h7-14H,1-6H3.
What are the key properties of tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate?
tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate has a molecular weight of 326.44 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-methyl-2-[3-(4-methylphenyl)phenoxy]propanoate is sourced from PubChem (CID 59138328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).