C22H37NO3 — CID 18766479
tert-butyl 2-methyl-2-[3-[2-(4-methylpentylamino)ethyl]phenoxy]propanoate (PubChem CID 18766479) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[3-[2-(4-methylpentylamino)ethyl]phenoxy]propanoate.
| Compound Name | tert-butyl 2-methyl-2-[3-[2-(4-methylpentylamino)ethyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 18766479 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl 2-methyl-2-[3-[2-(4-methylpentylamino)ethyl]phenoxy]propanoate |
| SMILES | CC(C)CCCNCCc1cccc(OC(C)(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C22H37NO3/c1-17(2)10-9-14-23-15-13-18-11-8-12-19(16-18)25-22(6,7)20(24)26-21(3,4)5/h8,11-12,16-17,23H,9-10,13-15H2,1-7H3 |
| InChIKey | OOWKNLPCLWNBED-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|