C16H23IO4S — CID 143092748
ethyl 2-[3-(4-iodosulfanyloxybutyl)phenoxy]-2-methylpropanoate (PubChem CID 143092748) has the molecular formula C16H23IO4S and a molecular weight of 438.33 g/mol. Its IUPAC name is ethyl 2-[3-(4-iodosulfanyloxybutyl)phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[3-(4-iodosulfanyloxybutyl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 143092748 |
| Molecular Formula | C16H23IO4S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | ethyl 2-[3-(4-iodosulfanyloxybutyl)phenoxy]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)Oc1cccc(CCCCOSI)c1 |
| InChI | InChI=1S/C16H23IO4S/c1-4-19-15(18)16(2,3)21-14-10-7-9-13(12-14)8-5-6-11-20-22-17/h7,9-10,12H,4-6,8,11H2,1-3H3 |
| InChIKey | HJTGLUDEUZAUSC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|