C26H38BrN3O5 — CID 11307404
ethyl 2-[3-[4-(6-bromo-2-heptyl-3,5-dioxo-1,2,4-triazin-4-yl)butyl]phenoxy]-2-methylpropanoate (PubChem CID 11307404) has the molecular formula C26H38BrN3O5 and a molecular weight of 552.51 g/mol. Its IUPAC name is ethyl 2-[3-[4-(6-bromo-2-heptyl-3,5-dioxo-1,2,4-triazin-4-yl)butyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[3-[4-(6-bromo-2-heptyl-3,5-dioxo-1,2,4-triazin-4-yl)butyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 11307404 |
| Molecular Formula | C26H38BrN3O5 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | ethyl 2-[3-[4-(6-bromo-2-heptyl-3,5-dioxo-1,2,4-triazin-4-yl)butyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCn1nc(Br)c(=O)n(CCCCc2cccc(OC(C)(C)C(=O)OCC)c2)c1=O |
| InChI | InChI=1S/C26H38BrN3O5/c1-5-7-8-9-11-18-30-25(33)29(23(31)22(27)28-30)17-12-10-14-20-15-13-16-21(19-20)35-26(3,4)24(32)34-6-2/h13,15-16,19H,5-12,14,17-18H2,1-4H3 |
| InChIKey | YIYWBQQHEHMXER-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|