C29H41F3N3O6- — CID 154075595
2-[3-[5-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]pentyl]phenoxy]-2-methylpropanoate (PubChem CID 154075595) has the molecular formula C29H41F3N3O6- and a molecular weight of 584.66 g/mol. Its IUPAC name is 2-[3-[5-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]pentyl]phenoxy]-2-methylpropanoate.
| Compound Name | 2-[3-[5-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]pentyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 154075595 |
| Molecular Formula | C29H41F3N3O6- |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 2-[3-[5-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]pentyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCn1c(=O)c(OCCCCCc2cccc(OC(C)(C)C(=O)[O-])c2)nn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C29H42F3N3O6/c1-4-5-6-7-10-18-34-25(36)24(33-35(27(34)39)19-13-17-29(30,31)32)40-20-11-8-9-14-22-15-12-16-23(21-22)41-28(2,3)26(37)38/h12,15-16,21H,4-11,13-14,17-20H2,1-3H3,(H,37,38)/p-1 |
| InChIKey | ZBJONDCGZPJWSG-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 115.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|