C22H28F3N3O6 — CID 68811739
2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]propanoic acid (PubChem CID 68811739) has the molecular formula C22H28F3N3O6 and a molecular weight of 487.48 g/mol. Its IUPAC name is 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 68811739 |
| Molecular Formula | C22H28F3N3O6 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 2-methyl-2-[4-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxy]butyl]phenoxy]propanoic acid |
| SMILES | Cn1c(=O)c(OCCCCc2ccc(OC(C)(C)C(=O)O)cc2)nn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C22H28F3N3O6/c1-21(2,19(30)31)34-16-10-8-15(9-11-16)7-4-5-14-33-17-18(29)27(3)20(32)28(26-17)13-6-12-22(23,24)25/h8-11H,4-7,12-14H2,1-3H3,(H,30,31) |
| InChIKey | QNLAIQGDNFPQBL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|