C28H41F3N4O5 — CID 11853594
2-[3-[4-[[2-heptyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]-2-methylpropanoic acid (PubChem CID 11853594) has the molecular formula C28H41F3N4O5 and a molecular weight of 570.65 g/mol. Its IUPAC name is 2-[3-[4-[[2-heptyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[4-[[2-heptyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11853594 |
| Molecular Formula | C28H41F3N4O5 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | 2-[3-[4-[[2-heptyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCn1nc(NCCCCc2cccc(OC(C)(C)C(=O)O)c2)c(=O)n(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C28H41F3N4O5/c1-4-5-6-7-10-19-35-26(39)34(18-12-16-28(29,30)31)24(36)23(33-35)32-17-9-8-13-21-14-11-15-22(20-21)40-27(2,3)25(37)38/h11,14-15,20H,4-10,12-13,16-19H2,1-3H3,(H,32,33)(H,37,38) |
| InChIKey | JODYTKSGBYJQGB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|