C20H25F3N4O5 — CID 68811103
2-methyl-2-[3-[2-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]ethyl]phenoxy]propanoic acid (PubChem CID 68811103) has the molecular formula C20H25F3N4O5 and a molecular weight of 458.44 g/mol. Its IUPAC name is 2-methyl-2-[3-[2-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]ethyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[3-[2-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]ethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 68811103 |
| Molecular Formula | C20H25F3N4O5 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 2-methyl-2-[3-[2-[[2-methyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]ethyl]phenoxy]propanoic acid |
| SMILES | Cn1nc(NCCc2cccc(OC(C)(C)C(=O)O)c2)c(=O)n(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C20H25F3N4O5/c1-19(2,17(29)30)32-14-7-4-6-13(12-14)8-10-24-15-16(28)27(18(31)26(3)25-15)11-5-9-20(21,22)23/h4,6-7,12H,5,8-11H2,1-3H3,(H,24,25)(H,29,30) |
| InChIKey | NCBKOVMHXKILPQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |