C24H33F3N4O5 — CID 68810710
2-methyl-2-[3-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]pentanoic acid (PubChem CID 68810710) has the molecular formula C24H33F3N4O5 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-methyl-2-[3-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]pentanoic acid.
| Compound Name | 2-methyl-2-[3-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 68810710 |
| Molecular Formula | C24H33F3N4O5 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-methyl-2-[3-[4-[[4-methyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]amino]butyl]phenoxy]pentanoic acid |
| SMILES | CCCC(C)(Oc1cccc(CCCCNc2nn(CCCC(F)(F)F)c(=O)n(C)c2=O)c1)C(=O)O |
| InChI | InChI=1S/C24H33F3N4O5/c1-4-12-23(2,21(33)34)36-18-11-7-10-17(16-18)9-5-6-14-28-19-20(32)30(3)22(35)31(29-19)15-8-13-24(25,26)27/h7,10-11,16H,4-6,8-9,12-15H2,1-3H3,(H,28,29)(H,33,34) |
| InChIKey | DZXJWWAUWRQIJA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|