C31H42N4O5 — CID 68813452
2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoic acid (PubChem CID 68813452) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68813452 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 2-[3-[4-[(4-benzyl-2-heptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]butyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCn1nc(NCCCCc2cccc(OC(C)(C)C(=O)O)c2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C31H42N4O5/c1-4-5-6-7-13-21-35-30(39)34(23-25-16-9-8-10-17-25)28(36)27(33-35)32-20-12-11-15-24-18-14-19-26(22-24)40-31(2,3)29(37)38/h8-10,14,16-19,22H,4-7,11-13,15,20-21,23H2,1-3H3,(H,32,33)(H,37,38) |
| InChIKey | VJLYKVARVIHWOX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|