C28H43N3O6 — CID 59298844
ethyl 2-[3-[5-[(2,4-dibutyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]pentyl]phenoxy]-2-methylpropanoate (PubChem CID 59298844) has the molecular formula C28H43N3O6 and a molecular weight of 517.67 g/mol. Its IUPAC name is ethyl 2-[3-[5-[(2,4-dibutyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]pentyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[3-[5-[(2,4-dibutyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]pentyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 59298844 |
| Molecular Formula | C28H43N3O6 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | ethyl 2-[3-[5-[(2,4-dibutyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]pentyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCn1nc(OCCCCCc2cccc(OC(C)(C)C(=O)OCC)c2)c(=O)n(CCCC)c1=O |
| InChI | InChI=1S/C28H43N3O6/c1-6-9-18-30-25(32)24(29-31(27(30)34)19-10-7-2)36-20-13-11-12-15-22-16-14-17-23(21-22)37-28(4,5)26(33)35-8-3/h14,16-17,21H,6-13,15,18-20H2,1-5H3 |
| InChIKey | DWXRVWSMKIBHLC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 101.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|