C23H33N3O6 — CID 68811676
2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]ethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 68811676) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]ethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]ethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68811676 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)oxy]ethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCn1c(=O)c(OCCc2ccc(OC(C)(C)C(=O)O)cc2)nn(C)c1=O |
| InChI | InChI=1S/C23H33N3O6/c1-5-6-7-8-9-15-26-20(27)19(24-25(4)22(26)30)31-16-14-17-10-12-18(13-11-17)32-23(2,3)21(28)29/h10-13H,5-9,14-16H2,1-4H3,(H,28,29) |
| InChIKey | UMHILCTWTHSRMC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|