C31H50N4O5 — CID 59298839
ethyl 2-[4-[2-[(2,4-diheptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenoxy]-2-methylpropanoate (PubChem CID 59298839) has the molecular formula C31H50N4O5 and a molecular weight of 558.76 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(2,4-diheptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenoxy]-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[2-[(2,4-diheptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 59298839 |
| Molecular Formula | C31H50N4O5 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | ethyl 2-[4-[2-[(2,4-diheptyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenoxy]-2-methylpropanoate |
| SMILES | CCCCCCCn1nc(NCCc2ccc(OC(C)(C)C(=O)OCC)cc2)c(=O)n(CCCCCCC)c1=O |
| InChI | InChI=1S/C31H50N4O5/c1-6-9-11-13-15-23-34-28(36)27(33-35(30(34)38)24-16-14-12-10-7-2)32-22-21-25-17-19-26(20-18-25)40-31(4,5)29(37)39-8-3/h17-20H,6-16,21-24H2,1-5H3,(H,32,33) |
| InChIKey | FSZUWMUPNWQMHK-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|