C25H38N4O4S — CID 59298847
ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoate (PubChem CID 59298847) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoate.
| Compound Name | ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoate |
|---|---|
| PubChem CID | 59298847 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoate |
| SMILES | CCCCCCCn1c(=O)c(NCCc2ccc(SC(C)(C)C(=O)OCC)cc2)nn(C)c1=O |
| InChI | InChI=1S/C25H38N4O4S/c1-6-8-9-10-11-18-29-22(30)21(27-28(5)24(29)32)26-17-16-19-12-14-20(15-13-19)34-25(3,4)23(31)33-7-2/h12-15H,6-11,16-18H2,1-5H3,(H,26,27) |
| InChIKey | NFLAKJHSLQYCQT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|