C23H34N4O4S — CID 11626792
2-[4-[2-[(2-heptyl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoic acid (PubChem CID 11626792) has the molecular formula C23H34N4O4S and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[4-[2-[(2-heptyl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[(2-heptyl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11626792 |
| Molecular Formula | C23H34N4O4S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[4-[2-[(2-heptyl-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CCCCCCCn1nc(NCCc2ccc(SC(C)(C)C(=O)O)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C23H34N4O4S/c1-5-6-7-8-9-16-27-22(31)26(4)20(28)19(25-27)24-15-14-17-10-12-18(13-11-17)32-23(2,3)21(29)30/h10-13H,5-9,14-16H2,1-4H3,(H,24,25)(H,29,30) |
| InChIKey | OVZZGPNMQGHUBX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|