C26H40N4O4S — CID 143286169
ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylbutanoate (PubChem CID 143286169) has the molecular formula C26H40N4O4S and a molecular weight of 504.70 g/mol. Its IUPAC name is ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylbutanoate.
| Compound Name | ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylbutanoate |
|---|---|
| PubChem CID | 143286169 |
| Molecular Formula | C26H40N4O4S |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | ethyl 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylbutanoate |
| SMILES | CCCCCCCn1c(=O)c(NCCc2ccc(SC(C)(CC)C(=O)OCC)cc2)nn(C)c1=O |
| InChI | InChI=1S/C26H40N4O4S/c1-6-9-10-11-12-19-30-23(31)22(28-29(5)25(30)33)27-18-17-20-13-15-21(16-14-20)35-26(4,7-2)24(32)34-8-3/h13-16H,6-12,17-19H2,1-5H3,(H,27,28) |
| InChIKey | HPYVNMQDFZYPLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|