C24H36N4O6 — CID 68810276
2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 68810276) has the molecular formula C24H36N4O6 and a molecular weight of 476.57 g/mol. Its IUPAC name is 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68810276 |
| Molecular Formula | C24H36N4O6 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-[4-[3-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]propoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CCCCCCCn1c(=O)c(NCCCOc2ccc(OC(C)(C)C(=O)O)cc2)nn(C)c1=O |
| InChI | InChI=1S/C24H36N4O6/c1-5-6-7-8-9-16-28-21(29)20(26-27(4)23(28)32)25-15-10-17-33-18-11-13-19(14-12-18)34-24(2,3)22(30)31/h11-14H,5-10,15-17H2,1-4H3,(H,25,26)(H,30,31) |
| InChIKey | XDMCRZRRXHCBDD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|