C25H38N4O4S — CID 68811779
2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpentanoic acid (PubChem CID 68811779) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpentanoic acid.
| Compound Name | 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpentanoic acid |
|---|---|
| PubChem CID | 68811779 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[4-[2-[(4-heptyl-2-methyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]phenyl]sulfanyl-2-methylpentanoic acid |
| SMILES | CCCCCCCn1c(=O)c(NCCc2ccc(SC(C)(CCC)C(=O)O)cc2)nn(C)c1=O |
| InChI | InChI=1S/C25H38N4O4S/c1-5-7-8-9-10-18-29-22(30)21(27-28(4)24(29)33)26-17-15-19-11-13-20(14-12-19)34-25(3,16-6-2)23(31)32/h11-14H,5-10,15-18H2,1-4H3,(H,26,27)(H,31,32) |
| InChIKey | NPBBBHFWYUNOFI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|