C17H29F3N4O3 — CID 68811737
4-heptyl-6-(3-hydroxypropylamino)-2-(4,4,4-trifluorobutyl)-1,2,4-triazine-3,5-dione (PubChem CID 68811737) has the molecular formula C17H29F3N4O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-heptyl-6-(3-hydroxypropylamino)-2-(4,4,4-trifluorobutyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 4-heptyl-6-(3-hydroxypropylamino)-2-(4,4,4-trifluorobutyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 68811737 |
| Molecular Formula | C17H29F3N4O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 4-heptyl-6-(3-hydroxypropylamino)-2-(4,4,4-trifluorobutyl)-1,2,4-triazine-3,5-dione |
| SMILES | CCCCCCCn1c(=O)c(NCCCO)nn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C17H29F3N4O3/c1-2-3-4-5-6-11-23-15(26)14(21-10-8-13-25)22-24(16(23)27)12-7-9-17(18,19)20/h25H,2-13H2,1H3,(H,21,22) |
| InChIKey | RUJHCNQHYPDFBJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|