C27H38F3N3O6 — CID 150626067
2-[4-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxymethyl]phenoxy]propyl propanoate (PubChem CID 150626067) has the molecular formula C27H38F3N3O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is 2-[4-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxymethyl]phenoxy]propyl propanoate.
| Compound Name | 2-[4-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxymethyl]phenoxy]propyl propanoate |
|---|---|
| PubChem CID | 150626067 |
| Molecular Formula | C27H38F3N3O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 2-[4-[[4-heptyl-3,5-dioxo-2-(4,4,4-trifluorobutyl)-1,2,4-triazin-6-yl]oxymethyl]phenoxy]propyl propanoate |
| SMILES | CCCCCCCn1c(=O)c(OCc2ccc(OC(C)COC(=O)CC)cc2)nn(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C27H38F3N3O6/c1-4-6-7-8-9-16-32-25(35)24(31-33(26(32)36)17-10-15-27(28,29)30)38-19-21-11-13-22(14-12-21)39-20(3)18-37-23(34)5-2/h11-14,20H,4-10,15-19H2,1-3H3 |
| InChIKey | IWXIAZKTPCKZEJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 101.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|