C31H48F3N3O4S — CID 143092765
ethane;ethyl 2-[6-[4-[6-hexyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-2-yl]butyl]cyclohepta-1,4,6-trien-1-yl]sulfanylpropanoate (PubChem CID 143092765) has the molecular formula C31H48F3N3O4S and a molecular weight of 615.80 g/mol. Its IUPAC name is ethane;ethyl 2-[6-[4-[6-hexyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-2-yl]butyl]cyclohepta-1,4,6-trien-1-yl]sulfanylpropanoate.
| Compound Name | ethane;ethyl 2-[6-[4-[6-hexyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-2-yl]butyl]cyclohepta-1,4,6-trien-1-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 143092765 |
| Molecular Formula | C31H48F3N3O4S |
| Molecular Weight | 615.80 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | ethane;ethyl 2-[6-[4-[6-hexyl-3,5-dioxo-4-(4,4,4-trifluorobutyl)-1,2,4-triazin-2-yl]butyl]cyclohepta-1,4,6-trien-1-yl]sulfanylpropanoate |
| SMILES | CC.CCCCCCc1nn(CCCCC2=CC(SC(C)C(=O)OCC)=CCC=C2)c(=O)n(CCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C29H42F3N3O4S.C2H6/c1-4-6-7-8-17-25-26(36)34(19-13-18-29(30,31)32)28(38)35(33-25)20-12-11-15-23-14-9-10-16-24(21-23)40-22(3)27(37)39-5-2;1-2/h9,14,16,21-22H,4-8,10-13,15,17-20H2,1-3H3;1-2H3 |
| InChIKey | JXKAIUQDGOCYMR-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.80 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|